Products 1246819-97-5
CAS 1246819-97-5 appears in our catalog under these names: Heptanal-d14, Heptanal-d14, 98 atom % D, min 96% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2,5mg, 25mg, 0,25g, 0,1g.
1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecadeuterioheptan-1-one (CAS 1246819-97-5) is a chemical compound with the molecular formula C7H14O and a molecular weight of 128.27 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecadeuterioheptan-1-one. InChIKey: FXHGMKSSBGDXIY-OBYKGMMLSA-N.
| Molecular formula | C7H14O |
|---|---|
| Molecular weight | 128.27 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecadeuterioheptan-1-one |
| InChIKey | FXHGMKSSBGDXIY-OBYKGMMLSA-N |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Heptanal-d14, Heptanal-d14, 98 atom % D, 98% (CP)