CAS 1246820-13-2 is the registry number for rac-trans 3’-Thiomethyl Nicotine Dihydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methanethiol (CAS 1246820-13-2) is a chemical compound with the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. IUPAC name: [(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methanethiol. InChIKey: YZZOQRDSBWHFON-GHMZBOCLSA-N.
| Molecular formula | C11H16N2S |
|---|---|
| Molecular weight | 208.33 g/mol |
| IUPAC name | [(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methanethiol |
| InChIKey | YZZOQRDSBWHFON-GHMZBOCLSA-N |
| SMILES | CN1CC[C@@H]([C@H]1C2=CN=CC=C2)CS |
Computed by PubChem (NCBI)