CAS 1246820-48-3 appears in our catalog under these names: 3-Bromo-1,2-propanediol-d5, 3-Bromopropane-1,2-diol-d5, 3-Bromo-1,2-propanediol-d5, >95% (GC). Offered by: Biosynth, MedChemExpress, TRC. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 1 mg.
3-bromo-1,1,2,3,3-pentadeuteriopropane-1,2-diol (CAS 1246820-48-3) is a chemical compound with the molecular formula C3H7BrO2 and a molecular weight of 160.02 g/mol. IUPAC name: 3-bromo-1,1,2,3,3-pentadeuteriopropane-1,2-diol. InChIKey: SIBFQOUHOCRXDL-UXXIZXEISA-N.
| Molecular formula | C3H7BrO2 |
|---|---|
| Molecular weight | 160.02 g/mol |
| IUPAC name | 3-bromo-1,1,2,3,3-pentadeuteriopropane-1,2-diol |
| InChIKey | SIBFQOUHOCRXDL-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Br)O)O |
Computed by PubChem (NCBI)