Products 1246820-56-3
CAS 1246820-56-3 appears in our catalog under these names: 5,6-Diamino-4-hydroxypyrimidine-13C,15N, 4,5-Diamino-6-hydroxypyrimidine-13C,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
4-amino-5-(15N)azanyl-(413C)1H-pyrimidin-6-one (CAS 1246820-56-3) is a chemical compound with the molecular formula C4H6N4O and a molecular weight of 128.10 g/mol. IUPAC name: 4-amino-5-(15N)azanyl-(413C)1H-pyrimidin-6-one. InChIKey: PWRHKLKFADDKHS-ZIEKVONGSA-N.
| Molecular formula | C4H6N4O |
|---|---|
| Molecular weight | 128.10 g/mol |
| IUPAC name | 4-amino-5-(15N)azanyl-(413C)1H-pyrimidin-6-one |
| InChIKey | PWRHKLKFADDKHS-ZIEKVONGSA-N |
| SMILES | C1=N[13C](=C(C(=O)N1)[15NH2])N |
Computed by PubChem (NCBI)