Products 1246820-67-6
CAS 1246820-67-6 appears in our catalog under these names: (S)-N-Methyl-d5 Pregabalin, (S)-N-Methyl pregabalin-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(3S)-2,2-dideuterio-5-methyl-3-[(trideuteriomethylamino)methyl]hexanoic acid (CAS 1246820-67-6) is a chemical compound with the molecular formula C9H19NO2 and a molecular weight of 178.28 g/mol. IUPAC name: (3S)-2,2-dideuterio-5-methyl-3-[(trideuteriomethylamino)methyl]hexanoic acid. InChIKey: MADUVMLGQASXOK-GLOPLDIOSA-N.
| Molecular formula | C9H19NO2 |
|---|---|
| Molecular weight | 178.28 g/mol |
| IUPAC name | (3S)-2,2-dideuterio-5-methyl-3-[(trideuteriomethylamino)methyl]hexanoic acid |
| InChIKey | MADUVMLGQASXOK-GLOPLDIOSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@@H](CC(C)C)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)