CAS 1246820-76-7 is the registry number for 4-Aminophenol-13C6, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1246820-76-7) is a chemical compound with the molecular formula C6H7NO and a molecular weight of 115.082 g/mol. IUPAC name: 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: PLIKAWJENQZMHA-IDEBNGHGSA-N.
| Molecular formula | C6H7NO |
|---|---|
| Molecular weight | 115.082 g/mol |
| IUPAC name | 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | PLIKAWJENQZMHA-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1N)O |
Computed by PubChem (NCBI)