Products 1246820-77-8
CAS 1246820-77-8 appears in our catalog under these names: 2,5-Pyridinedicarboxylic Acid-d3, >95% (HPLC), Pyridine-2,5-dicarboxylic-d3 acid. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
3,4,6-trideuteriopyridine-2,5-dicarboxylic acid (CAS 1246820-77-8) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 170.14 g/mol. IUPAC name: 3,4,6-trideuteriopyridine-2,5-dicarboxylic acid. InChIKey: LVPMIMZXDYBCDF-CBYSEHNBSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 3,4,6-trideuteriopyridine-2,5-dicarboxylic acid |
| InChIKey | LVPMIMZXDYBCDF-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1C(=O)O)[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)