CAS 1246820-80-3 is the registry number for rac-Rotigotine-D3 Methyl Ether. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 5 mg, 25 mg, 50 mg.
5-methoxy-N-(2-thiophen-2-ylethyl)-N-(3,3,3-trideuteriopropyl)-1,2,3,4-tetrahydronaphthalen-2-amine (CAS 1246820-80-3) is a chemical compound with the molecular formula C20H27NOS and a molecular weight of 332.5 g/mol. IUPAC name: 5-methoxy-N-(2-thiophen-2-ylethyl)-N-(3,3,3-trideuteriopropyl)-1,2,3,4-tetrahydronaphthalen-2-amine. InChIKey: AXOQYAWBBDSEMG-FIBGUPNXSA-N.
| Molecular formula | C20H27NOS |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 5-methoxy-N-(2-thiophen-2-ylethyl)-N-(3,3,3-trideuteriopropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChIKey | AXOQYAWBBDSEMG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCN(CCC1=CC=CS1)C2CCC3=C(C2)C=CC=C3OC |
Computed by PubChem (NCBI)