CAS 1246820-81-4 appears in our catalog under these names: Tetrachlorophenol-13C6, 2,3,4,6-Tetrachlorophenol 13C6, 2,4,5,6-Tetrachlorophenol-13C6, >95% (HPLC), 2,4,5,6-Tetrachlorophenol-13C6. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg.
2,3,4,6-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1246820-81-4) is a chemical compound with the molecular formula C6H2Cl4O and a molecular weight of 237.8 g/mol. IUPAC name: 2,3,4,6-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: VGVRPFIJEJYOFN-IDEBNGHGSA-N.
| Molecular formula | C6H2Cl4O |
|---|---|
| Molecular weight | 237.8 g/mol |
| IUPAC name | 2,3,4,6-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | VGVRPFIJEJYOFN-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13C]([13C](=[13C]1Cl)Cl)Cl)O)Cl |
Computed by PubChem (NCBI)