CAS 1246820-85-8 appears in our catalog under these names: Sotalol hydrochloride D6 100 µg/mL in Water, Sotalol-d6 Hydrochloride, >95% (HPLC), Sotalol–d6 (hydrochloride), Sotalol-d6 (hydrochloride), 98.98%. Offered by: Dr. Ehrenstorfer, TRC, GLPBio, MedChemExpress. Available pack sizes: 1ml, 10mg, 1mg, 5 mg, 10 mg, 1 mg.
N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride (CAS 1246820-85-8) is a chemical compound with the molecular formula C12H21ClN2O3S and a molecular weight of 314.86 g/mol. IUPAC name: N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride. InChIKey: VIDRYROWYFWGSY-TXHXQZCNSA-N.
| Molecular formula | C12H21ClN2O3S |
|---|---|
| Molecular weight | 314.86 g/mol |
| IUPAC name | N-[4-[2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride |
| InChIKey | VIDRYROWYFWGSY-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NCC(C1=CC=C(C=C1)NS(=O)(=O)C)O.Cl |
Computed by PubChem (NCBI)