CAS 1246820-97-2 is the registry number for 3–Amino–2,2–dimethylpropanamide–d6. Offered by: GLPBio. Available pack sizes: 10mg.
2-(aminomethyl)-3,3,3-trideuterio-2-(trideuteriomethyl)propanamide (CAS 1246820-97-2) is a chemical compound with the molecular formula C5H12N2O and a molecular weight of 122.20 g/mol. IUPAC name: 2-(aminomethyl)-3,3,3-trideuterio-2-(trideuteriomethyl)propanamide. InChIKey: HKQZJXVIXAPOPZ-WFGJKAKNSA-N.
| Molecular formula | C5H12N2O |
|---|---|
| Molecular weight | 122.20 g/mol |
| IUPAC name | 2-(aminomethyl)-3,3,3-trideuterio-2-(trideuteriomethyl)propanamide |
| InChIKey | HKQZJXVIXAPOPZ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(CN)(C(=O)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)