Products 1246832-96-1
CAS 1246832-96-1 is the registry number for (E/Z)-2-Cyano-3-methyl-2-pentenoic Acid Ethyl Ester-d3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 2-cyano-5,5,5-trideuterio-3-methylpent-2-enoate (CAS 1246832-96-1) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 170.22 g/mol. IUPAC name: ethyl 2-cyano-5,5,5-trideuterio-3-methylpent-2-enoate. InChIKey: WBPLDHMXQALQAT-FIBGUPNXSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | ethyl 2-cyano-5,5,5-trideuterio-3-methylpent-2-enoate |
| InChIKey | WBPLDHMXQALQAT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=C(C#N)C(=O)OCC)C |
Computed by PubChem (NCBI)