Products 1246833-00-0
CAS 1246833-00-0 appears in our catalog under these names: rac 1,2-Dioleoyl-3-chloropropanediol-d5, >95% (HPLC), (Rac)-1,2-Dioleoyl-3-chloropropanediol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg.
[3-chloro-1,1,2,3,3-pentadeuterio-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (CAS 1246833-00-0) is a chemical compound with the molecular formula C39H71ClO4 and a molecular weight of 644.5 g/mol. IUPAC name: [3-chloro-1,1,2,3,3-pentadeuterio-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate. InChIKey: BLQSPZHGZHJLGB-XZPPQYRVSA-N.
| Molecular formula | C39H71ClO4 |
|---|---|
| Molecular weight | 644.5 g/mol |
| IUPAC name | [3-chloro-1,1,2,3,3-pentadeuterio-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| InChIKey | BLQSPZHGZHJLGB-XZPPQYRVSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)OC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
Computed by PubChem (NCBI)