CAS 1246833-81-7 appears in our catalog under these names: Naftifine-d3 Hydrochloride, >95% (HPLC), Naftifine–d3 (hydrochloride), Naftifine-d3 hydrochloride, Naftifine-d3 (hydrochloride). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
(E)-N-(naphthalen-1-ylmethyl)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride (CAS 1246833-81-7) is a chemical compound with the molecular formula C21H22ClN and a molecular weight of 326.9 g/mol. IUPAC name: (E)-N-(naphthalen-1-ylmethyl)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride. InChIKey: OLUNPKFOFGZHRT-KLQXWDQSSA-N.
| Molecular formula | C21H22ClN |
|---|---|
| Molecular weight | 326.9 g/mol |
| IUPAC name | (E)-N-(naphthalen-1-ylmethyl)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine;hydrochloride |
| InChIKey | OLUNPKFOFGZHRT-KLQXWDQSSA-N |
| SMILES | [2H]C([2H])([2H])N(C/C=C/C1=CC=CC=C1)CC2=CC=CC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)