CAS 1246834-03-6 is the registry number for rac 1-Oleoyl-3-chloropropanediol-d5. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (E)-octadec-9-enoate (CAS 1246834-03-6) is a chemical compound with the molecular formula C21H39ClO3 and a molecular weight of 380.0 g/mol. IUPAC name: (3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (E)-octadec-9-enoate. InChIKey: GQUYTVRTHVOZHT-BJODDLMASA-N.
| Molecular formula | C21H39ClO3 |
|---|---|
| Molecular weight | 380.0 g/mol |
| IUPAC name | (3-chloro-1,1,2,3,3-pentadeuterio-2-hydroxypropyl) (E)-octadec-9-enoate |
| InChIKey | GQUYTVRTHVOZHT-BJODDLMASA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])Cl)O)OC(=O)CCCCCCC/C=C/CCCCCCCC |
Computed by PubChem (NCBI)