CAS 1246857-77-1 is the registry number for N-(2,6-Diisopropylphenyl)-4,5-dibromo-1,8-naphthalimide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6,7-dibromo-2-[2,6-di(propan-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione (CAS 1246857-77-1) is a chemical compound with the molecular formula C24H21Br2NO2 and a molecular weight of 515.2 g/mol. IUPAC name: 6,7-dibromo-2-[2,6-di(propan-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione. InChIKey: OOFUMCIIZFGRHV-UHFFFAOYSA-N.
| Molecular formula | C24H21Br2NO2 |
|---|---|
| Molecular weight | 515.2 g/mol |
| IUPAC name | 6,7-dibromo-2-[2,6-di(propan-2-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | OOFUMCIIZFGRHV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N2C(=O)C3=C4C(=CC=C(C4=C(C=C3)Br)Br)C2=O |
Computed by PubChem (NCBI)