CAS 1247006-25-2 is the registry number for 4-Bromo-2,6-diflluoro-n,n-dimethyl-benzenemethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(4-bromo-2,6-difluorophenyl)-N,N-dimethylmethanamine (CAS 1247006-25-2) is a chemical compound with the molecular formula C9H10BrF2N and a molecular weight of 250.08 g/mol. IUPAC name: 1-(4-bromo-2,6-difluorophenyl)-N,N-dimethylmethanamine. InChIKey: OREQSTOGSPRULV-UHFFFAOYSA-N.
| Molecular formula | C9H10BrF2N |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | 1-(4-bromo-2,6-difluorophenyl)-N,N-dimethylmethanamine |
| InChIKey | OREQSTOGSPRULV-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=C(C=C1F)Br)F |
Computed by PubChem (NCBI)