Products 1247014-33-0
CAS 1247014-33-0 is the registry number for Volvalerenal E. Offered by: MedChemExpress. Available pack sizes: 100 μL, 50 μL.
[(1R,4Z,8E,10R)-8-formyl-11,11-dimethyl-4-bicyclo[8.1.0]undeca-4,8-dienyl]methyl acetate (CAS 1247014-33-0) is a chemical compound with the molecular formula C17H24O3 and a molecular weight of 276.4 g/mol. IUPAC name: [(1R,4Z,8E,10R)-8-formyl-11,11-dimethyl-4-bicyclo[8.1.0]undeca-4,8-dienyl]methyl acetate. InChIKey: VGOHBZXHAWVRBT-SULDDGIRSA-N.
| Molecular formula | C17H24O3 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | [(1R,4Z,8E,10R)-8-formyl-11,11-dimethyl-4-bicyclo[8.1.0]undeca-4,8-dienyl]methyl acetate |
| InChIKey | VGOHBZXHAWVRBT-SULDDGIRSA-N |
| SMILES | CC(=O)OC/C/1=C\CC/C(=C\[C@@H]2[C@H](C2(C)C)CC1)/C=O |
Computed by PubChem (NCBI)
Synonyms:
Volvalerenal E