CAS 1247025-84-8 appears in our catalog under these names: {[3-(Dihydroxyboranyl)phenyl]methyl}triphenylphosphanium bromide, 97%, MitoB, MitoB (bromide), 99.8%. Offered by: Chemat Brand, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 50mg, 100mg, 25mg, 5 mg, 1 mg.
(3-boronophenyl)methyl-triphenylphosphanium bromide (CAS 1247025-84-8) is a chemical compound with the molecular formula C25H23BBrO2P and a molecular weight of 477.1 g/mol. IUPAC name: (3-boronophenyl)methyl-triphenylphosphanium bromide. InChIKey: VDNRROALFUZCBO-UHFFFAOYSA-M.
| Molecular formula | C25H23BBrO2P |
|---|---|
| Molecular weight | 477.1 g/mol |
| IUPAC name | (3-boronophenyl)methyl-triphenylphosphanium bromide |
| InChIKey | VDNRROALFUZCBO-UHFFFAOYSA-M |
| SMILES | B(C1=CC(=CC=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(O)O.[Br-] |
Computed by PubChem (NCBI)