CAS 1247053-40-2 is the registry number for 1-(4-Fluorophenyl)-5-methyl-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-fluorophenyl)-5-methylpyrazol-3-amine (CAS 1247053-40-2) is a chemical compound with the molecular formula C10H10FN3 and a molecular weight of 191.20 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methylpyrazol-3-amine. InChIKey: KVTPQQWGYTVBMR-UHFFFAOYSA-N.
| Molecular formula | C10H10FN3 |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methylpyrazol-3-amine |
| InChIKey | KVTPQQWGYTVBMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)