Products 124709-72-4
CAS 124709-72-4 appears in our catalog under these names: (S)-2-(4-Methylphenyl)propionic acid, 98%, 98%, (S)-2-(p-Tolyl)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-methylphenyl)propanoic acid (CAS 124709-72-4) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (2S)-2-(4-methylphenyl)propanoic acid. InChIKey: KDYOFXPLHVSIHS-QMMMGPOBSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (2S)-2-(4-methylphenyl)propanoic acid |
| InChIKey | KDYOFXPLHVSIHS-QMMMGPOBSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-(4-Methylphenyl)propionic acid, (S)-2-(4-Methylphenyl)propanoic acid, 2-(4-Methylphenyl)propionic acid, (S)-, (+)-2-(4-Methylphenyl)propionic acid, Benzeneacetic acid, alpha,4-dimethyl-, (S)-, Benzeneacetic acid, alpha,4-dimethyl-, (alphaS)-, (S)-2-(p-Tolyl)propanoic acid, (2S)-2-(4-methylphenyl)propanoic acid, Benzeneacetic acid, -alpha-,4-dimethyl-, (-alpha-S)- (9CI), (S)-(+)-2-(p-tolyl)propionic acid