Products 1247176-48-2
CAS 1247176-48-2 is the registry number for N-[1,1′:4′,1′′-Terphenyl]-4-yl-9-phenanthrenamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
N-[4-(4-phenylphenyl)phenyl]phenanthren-9-amine (CAS 1247176-48-2) is a chemical compound with the molecular formula C32H23N and a molecular weight of 421.5 g/mol. IUPAC name: N-[4-(4-phenylphenyl)phenyl]phenanthren-9-amine. InChIKey: KLFMRUCYJBGUSW-UHFFFAOYSA-N.
| Molecular formula | C32H23N |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | N-[4-(4-phenylphenyl)phenyl]phenanthren-9-amine |
| InChIKey | KLFMRUCYJBGUSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)