Products 2425814-19-1
CAS 2425814-19-1 is the registry number for N-(4-(phenanthren-9-yl)phenyl)-[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(4-phenanthren-9-ylphenyl)-2-phenylaniline (CAS 2425814-19-1) is a chemical compound with the molecular formula C32H23N and a molecular weight of 421.5 g/mol. IUPAC name: N-(4-phenanthren-9-ylphenyl)-2-phenylaniline. InChIKey: TXEYYNNUZKTJAO-UHFFFAOYSA-N.
| Molecular formula | C32H23N |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | N-(4-phenanthren-9-ylphenyl)-2-phenylaniline |
| InChIKey | TXEYYNNUZKTJAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC3=CC=C(C=C3)C4=CC5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)