CAS 1247481-70-4 is the registry number for 4-Fluoro-3-(trifluoromethyl)benzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-3-(trifluoromethyl)benzohydrazide (CAS 1247481-70-4) is a chemical compound with the molecular formula C8H6F4N2O and a molecular weight of 222.14 g/mol. IUPAC name: 4-fluoro-3-(trifluoromethyl)benzohydrazide. InChIKey: PMNKPEWRHXLVDI-UHFFFAOYSA-N.
| Molecular formula | C8H6F4N2O |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 4-fluoro-3-(trifluoromethyl)benzohydrazide |
| InChIKey | PMNKPEWRHXLVDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NN)C(F)(F)F)F |
Computed by PubChem (NCBI)