CAS 1247543-07-2 is the registry number for 5-Bromo-2-chloro-n-(2,2,2-trifluoro-ethyl)-nicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (CAS 1247543-07-2) is a chemical compound with the molecular formula C8H5BrClF3N2O and a molecular weight of 317.49 g/mol. IUPAC name: 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide. InChIKey: PESOTLNQCHEEDO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3N2O |
|---|---|
| Molecular weight | 317.49 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| InChIKey | PESOTLNQCHEEDO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)NCC(F)(F)F)Cl)Br |
Computed by PubChem (NCBI)