Products 1247574-31-7
CAS 1247574-31-7 appears in our catalog under these names: 1-((2-Chloro-4-fluorophenyl)methyl)piperidin-3-amine, 95%, 1-((2-Chloro-4-fluorophenyl)methyl)piperidin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-amine (CAS 1247574-31-7) is a chemical compound with the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. IUPAC name: 1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-amine. InChIKey: DZNJNOBGGIJDJQ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClFN2 |
|---|---|
| Molecular weight | 242.72 g/mol |
| IUPAC name | 1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-amine |
| InChIKey | DZNJNOBGGIJDJQ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=C(C=C(C=C2)F)Cl)N |
Computed by PubChem (NCBI)