CAS 1247630-44-9 appears in our catalog under these names: 6,7-Dihydro-4H-thieno(3,2-c)thiopyran-2-carboxylic acid 5,5-dioxide, 95%, 5,5-dioxo-6,7-dihydro-4H-thieno(3,2-c)thiopyran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,5-dioxo-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxylic acid (CAS 1247630-44-9) is a chemical compound with the molecular formula C8H8O4S2 and a molecular weight of 232.3 g/mol. IUPAC name: 5,5-dioxo-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxylic acid. InChIKey: XMSTWUXOVZVTBC-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S2 |
|---|---|
| Molecular weight | 232.3 g/mol |
| IUPAC name | 5,5-dioxo-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxylic acid |
| InChIKey | XMSTWUXOVZVTBC-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC2=C1SC(=C2)C(=O)O |
Computed by PubChem (NCBI)