Products 1247631-11-3

CAS 1247631-11-3 appears in our catalog under these names: 3-Difluoromethanesulfonylbenzene-1-sulfonyl chloride, 3-Difluoromethanesulfonylbenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.

3-(difluoromethylsulfonyl)benzenesulfonyl chloride (CAS 1247631-11-3) is a chemical compound with the molecular formula C7H5ClF2O4S2 and a molecular weight of 290.7 g/mol. IUPAC name: 3-(difluoromethylsulfonyl)benzenesulfonyl chloride. InChIKey: GHXZXSOLVUHPID-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2O4S2
Molecular weight290.7 g/mol
IUPAC name3-(difluoromethylsulfonyl)benzenesulfonyl chloride
InChIKeyGHXZXSOLVUHPID-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)S(=O)(=O)C(F)F

Computed by PubChem (NCBI)