CAS 1247778-45-5 appears in our catalog under these names: 1-((5-Methyl-1,2,4-oxadiazol-3-yl)methyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-((5-Methyl-1,2,4-oxadiazol-3-yl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]triazole-4-carboxylic acid (CAS 1247778-45-5) is a chemical compound with the molecular formula C7H7N5O3 and a molecular weight of 209.16 g/mol. IUPAC name: 1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]triazole-4-carboxylic acid. InChIKey: NFQHTAYHAXKBCN-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O3 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]triazole-4-carboxylic acid |
| InChIKey | NFQHTAYHAXKBCN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)CN2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)