Products 1247879-16-8
CAS 1247879-16-8 appears in our catalog under these names: CycLuc1, CycLuc1, 99.72%, CycLuc1, 98%, (S)-2-(6,7-Dihydro-5H-thiazolo[4,5-f]indol-2-yl)-4,5-dihydrothiazole-4-carboxylic acid, 98%. Offered by: TargetMol, MedChemExpress, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 5mg, 10mg, 10mM/1mL, 50 mg, 10 mg, 25 mg, 5 mg, 100 mg.
(4S)-2-(6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 1247879-16-8) is a chemical compound with the molecular formula C13H11N3O2S2 and a molecular weight of 305.4 g/mol. IUPAC name: (4S)-2-(6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: HBZBAMXERPYTFS-SECBINFHSA-N.
| Molecular formula | C13H11N3O2S2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (4S)-2-(6,7-dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | HBZBAMXERPYTFS-SECBINFHSA-N |
| SMILES | C1CNC2=CC3=C(C=C21)N=C(S3)C4=N[C@H](CS4)C(=O)O |
Computed by PubChem (NCBI)