CAS 124788-09-6 is the registry number for Cyagard RF 1204. Offered by: TRC. Available pack sizes: 25mg.
1,4-bis(2-methylpropyl)-1,4-dioxo-1lambda5,4lambda5-diphosphinane-2,3,5,6-tetrol (CAS 124788-09-6) is a chemical compound with the molecular formula C12H26O6P2 and a molecular weight of 328.28 g/mol. IUPAC name: 1,4-bis(2-methylpropyl)-1,4-dioxo-1lambda5,4lambda5-diphosphinane-2,3,5,6-tetrol. InChIKey: YLYUAJJICVNRHL-UHFFFAOYSA-N.
| Molecular formula | C12H26O6P2 |
|---|---|
| Molecular weight | 328.28 g/mol |
| IUPAC name | 1,4-bis(2-methylpropyl)-1,4-dioxo-1lambda5,4lambda5-diphosphinane-2,3,5,6-tetrol |
| InChIKey | YLYUAJJICVNRHL-UHFFFAOYSA-N |
| SMILES | CC(C)CP1(=O)C(C(P(=O)(C(C1O)O)CC(C)C)O)O |
Computed by PubChem (NCBI)