Products 124789-77-1

CAS 124789-77-1 appears in our catalog under these names: Dichloro-1,3-thiazole-5-sulfonyl chloride, 95%, Dichloro-1,3-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.

2,4-dichloro-1,3-thiazole-5-sulfonyl chloride (CAS 124789-77-1) is a chemical compound with the molecular formula C3Cl3NO2S2 and a molecular weight of 252.5 g/mol. IUPAC name: 2,4-dichloro-1,3-thiazole-5-sulfonyl chloride. InChIKey: ZEZQYDKDJPFLNO-UHFFFAOYSA-N.

Identity
Molecular formulaC3Cl3NO2S2
Molecular weight252.5 g/mol
IUPAC name2,4-dichloro-1,3-thiazole-5-sulfonyl chloride
InChIKeyZEZQYDKDJPFLNO-UHFFFAOYSA-N
SMILESC1(=C(SC(=N1)Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)