CAS 124789-77-1 appears in our catalog under these names: Dichloro-1,3-thiazole-5-sulfonyl chloride, 95%, Dichloro-1,3-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
2,4-dichloro-1,3-thiazole-5-sulfonyl chloride (CAS 124789-77-1) is a chemical compound with the molecular formula C3Cl3NO2S2 and a molecular weight of 252.5 g/mol. IUPAC name: 2,4-dichloro-1,3-thiazole-5-sulfonyl chloride. InChIKey: ZEZQYDKDJPFLNO-UHFFFAOYSA-N.
| Molecular formula | C3Cl3NO2S2 |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 2,4-dichloro-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | ZEZQYDKDJPFLNO-UHFFFAOYSA-N |
| SMILES | C1(=C(SC(=N1)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)