CAS 1247990-59-5 appears in our catalog under these names: 4-(2,4-Difluorophenyl)butan-2-one, 95%, 4-(2,4-Difluorophenyl)butan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(2,4-difluorophenyl)butan-2-one (CAS 1247990-59-5) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: 4-(2,4-difluorophenyl)butan-2-one. InChIKey: BEYSSUKUIDCBQF-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)butan-2-one |
| InChIKey | BEYSSUKUIDCBQF-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)