CAS 124822-89-5 is the registry number for Famotidine Impurity 11 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(diaminomethylideneamino)-1,3-thiazol-5-yl]methyl carbamimidothioate;dihydrochloride (CAS 124822-89-5) is a chemical compound with the molecular formula C6H12Cl2N6S2 and a molecular weight of 303.2 g/mol. IUPAC name: [2-(diaminomethylideneamino)-1,3-thiazol-5-yl]methyl carbamimidothioate;dihydrochloride. InChIKey: HFYXOQTXTNPIMJ-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N6S2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | [2-(diaminomethylideneamino)-1,3-thiazol-5-yl]methyl carbamimidothioate;dihydrochloride |
| InChIKey | HFYXOQTXTNPIMJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)N=C(N)N)CSC(=N)N.Cl.Cl |
Computed by PubChem (NCBI)