CAS 88046-01-9 appears in our catalog under these names: (S)-((2-Guanidino-4-thiazolyl)methylisothiourea dihydrochloride, 95%, Famotidine EP Impurity H DiHCl, S-(2-Guanidino-4-thiazolyl)methylisothiourea Dihydrochloride, >95% (HPLC), (2-((Diaminomethylidene)amino)thiazol-4-yl)methyl Carbamimidothioate Dihydrochloride, (2-Guanidinothiazol-4-yl)methyl carbamimidothioate dihydrochloride 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g, on request, 10g, 25mg, 250mg.
[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methyl carbamimidothioate;dihydrochloride (CAS 88046-01-9) is a chemical compound with the molecular formula C6H12Cl2N6S2 and a molecular weight of 303.2 g/mol. IUPAC name: [2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methyl carbamimidothioate;dihydrochloride. InChIKey: FTKAAVQOOXXUGW-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N6S2 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | [2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methyl carbamimidothioate;dihydrochloride |
| InChIKey | FTKAAVQOOXXUGW-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N=C(N)N)CSC(=N)N.Cl.Cl |
Computed by PubChem (NCBI)