Products 1248231-47-1
CAS 1248231-47-1 is the registry number for 1-(1-Bromoethyl)-2-chloro-4,5-dimethoxybenzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1-bromoethyl)-2-chloro-4,5-dimethoxybenzene (CAS 1248231-47-1) is a chemical compound with the molecular formula C10H12BrClO2 and a molecular weight of 279.56 g/mol. IUPAC name: 1-(1-bromoethyl)-2-chloro-4,5-dimethoxybenzene. InChIKey: YSEDIHJUCBUKGK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClO2 |
|---|---|
| Molecular weight | 279.56 g/mol |
| IUPAC name | 1-(1-bromoethyl)-2-chloro-4,5-dimethoxybenzene |
| InChIKey | YSEDIHJUCBUKGK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1Cl)OC)OC)Br |
Computed by PubChem (NCBI)