Products 1248233-69-3

CAS 1248233-69-3 is the registry number for 2,2-Difluoro-3-hydroxy-4-methyl-pentanoic acid. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-3-hydroxy-4-methylpentanoic acid (CAS 1248233-69-3) is a chemical compound with the molecular formula C6H10F2O3 and a molecular weight of 168.14 g/mol. IUPAC name: 2,2-difluoro-3-hydroxy-4-methylpentanoic acid. InChIKey: RPDGATXUWOOFSA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10F2O3
Molecular weight168.14 g/mol
IUPAC name2,2-difluoro-3-hydroxy-4-methylpentanoic acid
InChIKeyRPDGATXUWOOFSA-UHFFFAOYSA-N
SMILESCC(C)C(C(C(=O)O)(F)F)O

Computed by PubChem (NCBI)