Products 1248331-97-6
CAS 1248331-97-6 is the registry number for 2-Fluoro-4-(2,2,2-trifluoroethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-4-(2,2,2-trifluoroethoxy)aniline (CAS 1248331-97-6) is a chemical compound with the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. IUPAC name: 2-fluoro-4-(2,2,2-trifluoroethoxy)aniline. InChIKey: KVJHWCDGFQWXQH-UHFFFAOYSA-N.
| Molecular formula | C8H7F4NO |
|---|---|
| Molecular weight | 209.14 g/mol |
| IUPAC name | 2-fluoro-4-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | KVJHWCDGFQWXQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)F)N |
Computed by PubChem (NCBI)