Products 1248549-80-5
CAS 1248549-80-5 is the registry number for 4-Acetamido-2,4-dimethylpentanoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-acetamido-2,4-dimethylpentanoic acid (CAS 1248549-80-5) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: 4-acetamido-2,4-dimethylpentanoic acid. InChIKey: KYALAZPPAPYEPV-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 4-acetamido-2,4-dimethylpentanoic acid |
| InChIKey | KYALAZPPAPYEPV-UHFFFAOYSA-N |
| SMILES | CC(CC(C)(C)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-acetamido-2,4-dimethylpentanoic acid