CAS 1248597-34-3 appears in our catalog under these names: 2-(tert-Butoxy)-4-fluoroaniline, 95%, 2-(tert-Butoxy)-4-fluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-fluoro-2-[(2-methylpropan-2-yl)oxy]aniline (CAS 1248597-34-3) is a chemical compound with the molecular formula C10H14FNO and a molecular weight of 183.22 g/mol. IUPAC name: 4-fluoro-2-[(2-methylpropan-2-yl)oxy]aniline. InChIKey: CDPWSESMTRSJDD-UHFFFAOYSA-N.
| Molecular formula | C10H14FNO |
|---|---|
| Molecular weight | 183.22 g/mol |
| IUPAC name | 4-fluoro-2-[(2-methylpropan-2-yl)oxy]aniline |
| InChIKey | CDPWSESMTRSJDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)