Products 1248803-37-3

CAS 1248803-37-3 appears in our catalog under these names: 2-azabicyclo(2.2.1)heptane-2-sulfonyl chloride, 98%, 2-Azabicyclo(2.2.1)heptane-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.

2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride (CAS 1248803-37-3) is a chemical compound with the molecular formula C6H10ClNO2S and a molecular weight of 195.67 g/mol. IUPAC name: 2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride. InChIKey: JTJDUIZFCHPANH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClNO2S
Molecular weight195.67 g/mol
IUPAC name2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride
InChIKeyJTJDUIZFCHPANH-UHFFFAOYSA-N
SMILESC1CC2CC1CN2S(=O)(=O)Cl

Computed by PubChem (NCBI)