CAS 1248920-72-0 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-thiol, >95% (HPLC), 2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-thiol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
2,2-dimethyl-3H-1-benzofuran-5-thiol (CAS 1248920-72-0) is a chemical compound with the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-5-thiol. InChIKey: KVCLATURXVNARU-UHFFFAOYSA-N.
| Molecular formula | C10H12OS |
|---|---|
| Molecular weight | 180.27 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-5-thiol |
| InChIKey | KVCLATURXVNARU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)S)C |
Computed by PubChem (NCBI)