CAS 1248954-00-8 is the registry number for (2-(tert-Butoxy)-4-methylphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
[4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]methanamine (CAS 1248954-00-8) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: [4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]methanamine. InChIKey: LJEDHLNIAXJDJD-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | [4-methyl-2-[(2-methylpropan-2-yl)oxy]phenyl]methanamine |
| InChIKey | LJEDHLNIAXJDJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CN)OC(C)(C)C |
Computed by PubChem (NCBI)