CAS 1248984-11-3 is the registry number for 1-N-Benzyl-2-bromobenzene-1,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-N-benzyl-2-bromobenzene-1,4-diamine (CAS 1248984-11-3) is a chemical compound with the molecular formula C13H13BrN2 and a molecular weight of 277.16 g/mol. IUPAC name: 1-N-benzyl-2-bromobenzene-1,4-diamine. InChIKey: PZJHSVXFKKQUPS-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2 |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 1-N-benzyl-2-bromobenzene-1,4-diamine |
| InChIKey | PZJHSVXFKKQUPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=C(C=C2)N)Br |
Computed by PubChem (NCBI)