CAS 1249-97-4 appears in our catalog under these names: Benzoyl leuco methylene blue, 96%, Methylene blue leucobenzoy, Benzoyl Leuco Methylene Blue, >96.0%(HPLC)(T), (3,7-Bis(dimethylamino)-10H-phenothiazin-10-yl)(phenyl)methanone 98%, Benzoylleucomethyleneblue, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 100g, 500g.
[3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone (CAS 1249-97-4) is a chemical compound with the molecular formula C23H23N3OS and a molecular weight of 389.5 g/mol. IUPAC name: [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone. InChIKey: ZKURGBYDCVNWKH-UHFFFAOYSA-N.
| Molecular formula | C23H23N3OS |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone |
| InChIKey | ZKURGBYDCVNWKH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)N(C3=C(S2)C=C(C=C3)N(C)C)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)