Products 1249029-93-3
CAS 1249029-93-3 appears in our catalog under these names: 4-Chloro-1-(4-fluorophenyl)-3-methyl-1h-pyrazol-5-amine, 95%, 4–Chloro–1–(4–fluorophenyl)–3–methyl–1H–pyrazol–5–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
4-chloro-1-(4-fluorophenyl)-3-methylpyrazol-5-amine (CAS 1249029-93-3) is a chemical compound with the molecular formula C10H9ClFN3 and a molecular weight of 225.65 g/mol. IUPAC name: 4-chloro-1-(4-fluorophenyl)-3-methylpyrazol-5-amine. InChIKey: QCYFGDHVYIWTHJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN3 |
|---|---|
| Molecular weight | 225.65 g/mol |
| IUPAC name | 4-chloro-1-(4-fluorophenyl)-3-methylpyrazol-5-amine |
| InChIKey | QCYFGDHVYIWTHJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Cl)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)