Products 1249090-53-6

CAS 1249090-53-6 is the registry number for Ethyl 2-(4-bromo-2-fluorophenyl)-2-chloroacetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-bromo-2-fluorophenyl)-2-chloroacetate (CAS 1249090-53-6) is a chemical compound with the molecular formula C10H9BrClFO2 and a molecular weight of 295.53 g/mol. IUPAC name: ethyl 2-(4-bromo-2-fluorophenyl)-2-chloroacetate. InChIKey: FMNGZOYGXDOZJW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9BrClFO2
Molecular weight295.53 g/mol
IUPAC nameethyl 2-(4-bromo-2-fluorophenyl)-2-chloroacetate
InChIKeyFMNGZOYGXDOZJW-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=C(C=C(C=C1)Br)F)Cl

Computed by PubChem (NCBI)