Products 1249222-77-2
CAS 1249222-77-2 is the registry number for 1-(4-Bromophenyl)-4-(chloromethyl)-1h-1,2,3-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-bromophenyl)-4-(chloromethyl)triazole (CAS 1249222-77-2) is a chemical compound with the molecular formula C9H7BrClN3 and a molecular weight of 272.53 g/mol. IUPAC name: 1-(4-bromophenyl)-4-(chloromethyl)triazole. InChIKey: DLBMQNOVSKGAOV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClN3 |
|---|---|
| Molecular weight | 272.53 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4-(chloromethyl)triazole |
| InChIKey | DLBMQNOVSKGAOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CCl)Br |
Computed by PubChem (NCBI)