CAS 1249274-01-8 appears in our catalog under these names: 1–(4–(Trifluoromethoxy)Phenyl)Propan–2–One, 1-(4-(Trifluoromethoxy)phenyl)propan-2-one, 95%, 95%, 1-(4-(TRIFLUOROMETHOXY)PHENYL)PROPAN-2-ONE, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 25g, 10g, 5g.
1-[4-(trifluoromethoxy)phenyl]propan-2-one (CAS 1249274-01-8) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]propan-2-one. InChIKey: LNSGIYHTBZBJHU-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]propan-2-one |
| InChIKey | LNSGIYHTBZBJHU-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC=C(C=C1)OC(F)(F)F |
Computed by PubChem (NCBI)