CAS 124937-52-6 appears in our catalog under these names: Tolterodine L-Tartrate, Tolterodine L-Tartrate, >95% (HPLC), Tolterodine Tartrate, Tolterodine tartrate/ 99.62% (existing batch purity), Tolterodine tartrate. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso), 250mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol (CAS 124937-52-6) is a chemical compound with the molecular formula C26H37NO7 and a molecular weight of 475.6 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol. InChIKey: TWHNMSJGYKMTRB-KXYUELECSA-N.
| Molecular formula | C26H37NO7 |
|---|---|
| Molecular weight | 475.6 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol |
| InChIKey | TWHNMSJGYKMTRB-KXYUELECSA-N |
| SMILES | CC1=CC(=C(C=C1)O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)